C24H25F7N2O6 — CID 127023215
(3aR,6aR)-5-[(3-fluorophenyl)methyl]-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023215) has the molecular formula C24H25F7N2O6 and a molecular weight of 570.46 g/mol. Its IUPAC name is (3aR,6aR)-5-[(3-fluorophenyl)methyl]-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,6aR)-5-[(3-fluorophenyl)methyl]-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023215 |
| Molecular Formula | C24H25F7N2O6 |
| Molecular Weight | 570.46 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | (3aR,6aR)-5-[(3-fluorophenyl)methyl]-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Fc1cccc(CN2C[C@@H]3COC[C@]3(COCc3ccncc3)C2)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23FN2O2.2C2HF3O2/c21-19-3-1-2-17(8-19)9-23-10-18-12-25-15-20(18,13-23)14-24-11-16-4-6-22-7-5-16;2*3-2(4,5)1(6)7/h1-8,18H,9-15H2;2*(H,6,7)/t18-,20-;;/m1../s1 |
| InChIKey | RDNAWCOEEPCXEZ-FOKFTXDMSA-N |
| XLogP | 4.15 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |