C25H28F6N2O7 — CID 127023216
(3aR,6aR)-5-[(2-methoxyphenyl)methyl]-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023216) has the molecular formula C25H28F6N2O7 and a molecular weight of 582.49 g/mol. Its IUPAC name is (3aR,6aR)-5-[(2-methoxyphenyl)methyl]-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,6aR)-5-[(2-methoxyphenyl)methyl]-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023216 |
| Molecular Formula | C25H28F6N2O7 |
| Molecular Weight | 582.49 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | (3aR,6aR)-5-[(2-methoxyphenyl)methyl]-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1ccccc1CN1C[C@@H]2COC[C@]2(COCc2ccncc2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26N2O3.2C2HF3O2/c1-24-20-5-3-2-4-18(20)10-23-11-19-13-26-16-21(19,14-23)15-25-12-17-6-8-22-9-7-17;2*3-2(4,5)1(6)7/h2-9,19H,10-16H2,1H3;2*(H,6,7)/t19-,21-;;/m1../s1 |
| InChIKey | MAXRTEFYDRSEDH-YYMFTFNESA-N |
| XLogP | 4.02 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |