C23H30F6N2O7 — CID 155837555
(3aS,6aR)-5-[(2-methoxyphenyl)methyl]-3a-(morpholin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155837555) has the molecular formula C23H30F6N2O7 and a molecular weight of 560.49 g/mol. Its IUPAC name is (3aS,6aR)-5-[(2-methoxyphenyl)methyl]-3a-(morpholin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,6aR)-5-[(2-methoxyphenyl)methyl]-3a-(morpholin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155837555 |
| Molecular Formula | C23H30F6N2O7 |
| Molecular Weight | 560.49 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (3aS,6aR)-5-[(2-methoxyphenyl)methyl]-3a-(morpholin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1ccccc1CN1C[C@@H]2COC[C@]2(CN2CCOCC2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H28N2O3.2C2HF3O2/c1-22-18-5-3-2-4-16(18)10-21-11-17-12-24-15-19(17,14-21)13-20-6-8-23-9-7-20;2*3-2(4,5)1(6)7/h2-5,17H,6-15H2,1H3;2*(H,6,7)/t17-,19+;;/m1../s1 |
| InChIKey | LMSJVEHKPJGRBH-QFZUCXBQSA-N |
| XLogP | 2.74 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |