C20H28F3NO5S — CID 155846304
(3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155846304) has the molecular formula C20H28F3NO5S and a molecular weight of 451.51 g/mol. Its IUPAC name is (3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155846304 |
| Molecular Formula | C20H28F3NO5S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1csc(CN2C[C@@H]3COC[C@]3(COCC3CCOCC3)C2)c1 |
| InChI | InChI=1S/C18H27NO3S.C2HF3O2/c1-2-17(23-7-1)9-19-8-16-11-22-14-18(16,12-19)13-21-10-15-3-5-20-6-4-15;3-2(4,5)1(6)7/h1-2,7,15-16H,3-6,8-14H2;(H,6,7)/t16-,18-;/m1./s1 |
| InChIKey | SJAUARZEZPDCBE-PHJLCXHGSA-N |
| XLogP | 3.27 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |