C22H23F6N3O6S — CID 155829976
N-[[(3aR,6aR)-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]pyridine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155829976) has the molecular formula C22H23F6N3O6S and a molecular weight of 571.50 g/mol. Its IUPAC name is N-[[(3aR,6aR)-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]pyridine-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[[(3aR,6aR)-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]pyridine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155829976 |
| Molecular Formula | C22H23F6N3O6S |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | N-[[(3aR,6aR)-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]pyridine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(NC[C@]12COC[C@H]1CN(Cc1cccs1)C2)c1cccnc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N3O2S.2C2HF3O2/c22-17(14-3-1-5-19-7-14)20-11-18-12-21(8-15(18)10-23-13-18)9-16-4-2-6-24-16;2*3-2(4,5)1(6)7/h1-7,15H,8-13H2,(H,20,22);2*(H,6,7)/t15-,18+;;/m1../s1 |
| InChIKey | JOXCOJRHYYRNJS-RZCPSWOESA-N |
| XLogP | 3.29 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |