C20H24F4N2O5 — CID 155852992
[(3aR,6aR)-3a-(morpholin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2-fluorophenyl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155852992) has the molecular formula C20H24F4N2O5 and a molecular weight of 448.41 g/mol. Its IUPAC name is [(3aR,6aR)-3a-(morpholin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2-fluorophenyl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,6aR)-3a-(morpholin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2-fluorophenyl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155852992 |
| Molecular Formula | C20H24F4N2O5 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [(3aR,6aR)-3a-(morpholin-4-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2-fluorophenyl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccccc1F)N1C[C@@H]2COC[C@]2(CN2CCOCC2)C1 |
| InChI | InChI=1S/C18H23FN2O3.C2HF3O2/c19-16-4-2-1-3-15(16)17(22)21-9-14-10-24-13-18(14,12-21)11-20-5-7-23-8-6-20;3-2(4,5)1(6)7/h1-4,14H,5-13H2;(H,6,7)/t14-,18+;/m1./s1 |
| InChIKey | SOKUMTHUTAHDKV-CQZNTPMBSA-N |
| XLogP | 1.88 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |