C15H22N2O4S2 — CID 97421150
(3aR,6aR)-5-cyclopropylsulfonyl-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole (PubChem CID 97421150) has the molecular formula C15H22N2O4S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is (3aR,6aR)-5-cyclopropylsulfonyl-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole.
| Compound Name | (3aR,6aR)-5-cyclopropylsulfonyl-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 97421150 |
| Molecular Formula | C15H22N2O4S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (3aR,6aR)-5-cyclopropylsulfonyl-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
| SMILES | Cc1nc(COC[C@]23COC[C@H]2CN(S(=O)(=O)C2CC2)C3)cs1 |
| InChI | InChI=1S/C15H22N2O4S2/c1-11-16-13(7-22-11)6-21-10-15-8-17(4-12(15)5-20-9-15)23(18,19)14-2-3-14/h7,12,14H,2-6,8-10H2,1H3/t12-,15+/m1/s1 |
| InChIKey | GZBNPKNFZFNQAT-DOMZBBRYSA-N |
| XLogP | 1.41 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |