C18H24N4OS — CID 124798965
4-[[(3aR,6aR)-2-(6-methylpyridazin-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole (PubChem CID 124798965) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 4-[[(3aR,6aR)-2-(6-methylpyridazin-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[(3aR,6aR)-2-(6-methylpyridazin-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 124798965 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 4-[[(3aR,6aR)-2-(6-methylpyridazin-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1ccc(N2C[C@@H]3CCC[C@]3(COCc3csc(C)n3)C2)nn1 |
| InChI | InChI=1S/C18H24N4OS/c1-13-5-6-17(21-20-13)22-8-15-4-3-7-18(15,11-22)12-23-9-16-10-24-14(2)19-16/h5-6,10,15H,3-4,7-9,11-12H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | NEGHCTBQOXQMRG-MAUKXSAKSA-N |
| XLogP | 3.37 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |