C21H26N2O3 — CID 124796194
1-[(3aR,6aR)-3a-[(6-methyl-2-pyridinyl)methoxymethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-(furan-2-yl)ethanone (PubChem CID 124796194) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[(3aR,6aR)-3a-[(6-methyl-2-pyridinyl)methoxymethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-(furan-2-yl)ethanone.
| Compound Name | 1-[(3aR,6aR)-3a-[(6-methyl-2-pyridinyl)methoxymethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 124796194 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[(3aR,6aR)-3a-[(6-methyl-2-pyridinyl)methoxymethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-(furan-2-yl)ethanone |
| SMILES | Cc1cccc(COC[C@]23CCC[C@H]2CN(C(=O)Cc2ccco2)C3)n1 |
| InChI | InChI=1S/C21H26N2O3/c1-16-5-2-7-18(22-16)13-25-15-21-9-3-6-17(21)12-23(14-21)20(24)11-19-8-4-10-26-19/h2,4-5,7-8,10,17H,3,6,9,11-15H2,1H3/t17-,21+/m0/s1 |
| InChIKey | TUGYTMRWVAFXCW-LAUBAEHRSA-N |
| XLogP | 3.37 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |