C22H26N2O2 — CID 124791486
1-[(3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-phenylethanone (PubChem CID 124791486) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-[(3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-phenylethanone.
| Compound Name | 1-[(3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 124791486 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-[(3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1C[C@@H]2CCC[C@]2(COCc2ccncc2)C1 |
| InChI | InChI=1S/C22H26N2O2/c25-21(13-18-5-2-1-3-6-18)24-14-20-7-4-10-22(20,16-24)17-26-15-19-8-11-23-12-9-19/h1-3,5-6,8-9,11-12,20H,4,7,10,13-17H2/t20-,22+/m0/s1 |
| InChIKey | HDQIKFBPIJIIDC-RBBKRZOGSA-N |
| XLogP | 3.47 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |