C21H24F6N4O5S — CID 155830598
2-[(3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-5-methyl-1,3,4-thiadiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155830598) has the molecular formula C21H24F6N4O5S and a molecular weight of 558.50 g/mol. Its IUPAC name is 2-[(3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-5-methyl-1,3,4-thiadiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-5-methyl-1,3,4-thiadiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155830598 |
| Molecular Formula | C21H24F6N4O5S |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 2-[(3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-5-methyl-1,3,4-thiadiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nnc(N2C[C@H]3CCC[C@@]3(COCc3ccncc3)C2)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N4OS.2C2HF3O2/c1-13-19-20-16(23-13)21-9-15-3-2-6-17(15,11-21)12-22-10-14-4-7-18-8-5-14;2*3-2(4,5)1(6)7/h4-5,7-8,15H,2-3,6,9-12H2,1H3;2*(H,6,7)/t15-,17+;;/m1../s1 |
| InChIKey | HFWCCOMFDBYMNX-CKDKJTBNSA-N |
| XLogP | 4.33 |
| TPSA | 125.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |