C22H25F3N2O5 — CID 155838002
[(3aS,6aS)-3a-(pyridin-3-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155838002) has the molecular formula C22H25F3N2O5 and a molecular weight of 454.45 g/mol. Its IUPAC name is [(3aS,6aS)-3a-(pyridin-3-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aS,6aS)-3a-(pyridin-3-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838002 |
| Molecular Formula | C22H25F3N2O5 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [(3aS,6aS)-3a-(pyridin-3-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccoc1C(=O)N1C[C@H]2CCC[C@@]2(COCc2cccnc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H24N2O3.C2HF3O2/c1-15-6-9-25-18(15)19(23)22-11-17-5-2-7-20(17,13-22)14-24-12-16-4-3-8-21-10-16;3-2(4,5)1(6)7/h3-4,6,8-10,17H,2,5,7,11-14H2,1H3;(H,6,7)/t17-,20+;/m1./s1 |
| InChIKey | SDYRNAVSCVTQLI-XLCHORMMSA-N |
| XLogP | 4.08 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |