C19H25F3N2O6S — CID 127022100
1-[(3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-methylsulfonylethanone;2,2,2-trifluoroacetic acid (PubChem CID 127022100) has the molecular formula C19H25F3N2O6S and a molecular weight of 466.48 g/mol. Its IUPAC name is 1-[(3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-methylsulfonylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-methylsulfonylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022100 |
| Molecular Formula | C19H25F3N2O6S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1-[(3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2-methylsulfonylethanone;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)CC(=O)N1C[C@H]2CCC[C@@]2(COCc2ccncc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N2O4S.C2HF3O2/c1-24(21,22)11-16(20)19-9-15-3-2-6-17(15,12-19)13-23-10-14-4-7-18-8-5-14;3-2(4,5)1(6)7/h4-5,7-8,15H,2-3,6,9-13H2,1H3;(H,6,7)/t15-,17+;/m1./s1 |
| InChIKey | JJIMNCLUJILPLR-KALLACGZSA-N |
| XLogP | 1.90 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |