C19H29N3O3 — CID 97364144
1-[(4aS,8aR)-4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(dimethylamino)ethanone (PubChem CID 97364144) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-[(4aS,8aR)-4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(dimethylamino)ethanone.
| Compound Name | 1-[(4aS,8aR)-4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 97364144 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 1-[(4aS,8aR)-4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(dimethylamino)ethanone |
| SMILES | CN(C)CC(=O)N1CC[C@H]2OCCC[C@@]2(COCc2ccncc2)C1 |
| InChI | InChI=1S/C19H29N3O3/c1-21(2)12-18(23)22-10-6-17-19(14-22,7-3-11-25-17)15-24-13-16-4-8-20-9-5-16/h4-5,8-9,17H,3,6-7,10-15H2,1-2H3/t17-,19+/m1/s1 |
| InChIKey | UAEOBIHVOFJEEK-MJGOQNOKSA-N |
| XLogP | 1.56 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |