C22H28F4N2O5 — CID 155866841
[4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(1-fluorocyclobutyl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155866841) has the molecular formula C22H28F4N2O5 and a molecular weight of 476.47 g/mol. Its IUPAC name is [4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(1-fluorocyclobutyl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(1-fluorocyclobutyl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155866841 |
| Molecular Formula | C22H28F4N2O5 |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(1-fluorocyclobutyl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(N1CCC2OCCCC2(COCc2ccncc2)C1)C1(F)CCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27FN2O3.C2HF3O2/c21-20(7-1-8-20)18(24)23-11-5-17-19(14-23,6-2-12-26-17)15-25-13-16-3-9-22-10-4-16;3-2(4,5)1(6)7/h3-4,9-10,17H,1-2,5-8,11-15H2;(H,6,7) |
| InChIKey | YKTPBAJHMPDBNQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |