C22H25F3N2O6 — CID 155834828
[4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155834828) has the molecular formula C22H25F3N2O6 and a molecular weight of 470.44 g/mol. Its IUPAC name is [4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155834828 |
| Molecular Formula | C22H25F3N2O6 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [4a-(pyridin-4-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccco1)N1CCC2OCCCC2(COCc2ccncc2)C1 |
| InChI | InChI=1S/C20H24N2O4.C2HF3O2/c23-19(17-3-1-11-25-17)22-10-6-18-20(14-22,7-2-12-26-18)15-24-13-16-4-8-21-9-5-16;3-2(4,5)1(6)7/h1,3-5,8-9,11,18H,2,6-7,10,12-15H2;(H,6,7) |
| InChIKey | GYAJYPZCPYAWBP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |