C20H28N2O3 — CID 97364069
1-[(4aR,8aR)-4a-(pyridin-3-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-cyclopropylethanone (PubChem CID 97364069) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-[(4aR,8aR)-4a-(pyridin-3-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-cyclopropylethanone.
| Compound Name | 1-[(4aR,8aR)-4a-(pyridin-3-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-cyclopropylethanone |
|---|---|
| PubChem CID | 97364069 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[(4aR,8aR)-4a-(pyridin-3-ylmethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-cyclopropylethanone |
| SMILES | O=C(CC1CC1)N1CC[C@H]2OCCC[C@]2(COCc2cccnc2)C1 |
| InChI | InChI=1S/C20H28N2O3/c23-19(11-16-4-5-16)22-9-6-18-20(14-22,7-2-10-25-18)15-24-13-17-3-1-8-21-12-17/h1,3,8,12,16,18H,2,4-7,9-11,13-15H2/t18-,20-/m1/s1 |
| InChIKey | AYDIUWQNXSTHDK-UYAOXDASSA-N |
| XLogP | 2.80 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |