C22H31NO3 — CID 97363506
1-[(4aS,8aR)-4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(2,3-dihydro-1H-inden-2-yl)ethanone (PubChem CID 97363506) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 1-[(4aS,8aR)-4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(2,3-dihydro-1H-inden-2-yl)ethanone.
| Compound Name | 1-[(4aS,8aR)-4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(2,3-dihydro-1H-inden-2-yl)ethanone |
|---|---|
| PubChem CID | 97363506 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-[(4aS,8aR)-4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(2,3-dihydro-1H-inden-2-yl)ethanone |
| SMILES | CCOC[C@@]12CCCO[C@@H]1CCN(C(=O)CC1Cc3ccccc3C1)C2 |
| InChI | InChI=1S/C22H31NO3/c1-2-25-16-22-9-5-11-26-20(22)8-10-23(15-22)21(24)14-17-12-18-6-3-4-7-19(18)13-17/h3-4,6-7,17,20H,2,5,8-16H2,1H3/t20-,22+/m1/s1 |
| InChIKey | SMPSNILKAUIXJA-IRLDBZIGSA-N |
| XLogP | 3.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |