C18H29NO3 — CID 131657522
1-[4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-cyclopent-2-en-1-ylethanone (PubChem CID 131657522) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 1-[4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-cyclopent-2-en-1-ylethanone.
| Compound Name | 1-[4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-cyclopent-2-en-1-ylethanone |
|---|---|
| PubChem CID | 131657522 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 1-[4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-cyclopent-2-en-1-ylethanone |
| SMILES | CCOCC12CCCOC1CCN(C(=O)CC1C=CCC1)C2 |
| InChI | InChI=1S/C18H29NO3/c1-2-21-14-18-9-5-11-22-16(18)8-10-19(13-18)17(20)12-15-6-3-4-7-15/h3,6,15-16H,2,4-5,7-14H2,1H3 |
| InChIKey | PUHMJKCLDCQMOP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|