C20H22F6N4O6S — CID 127021342
(3S,3aS,7aR)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-(pyridin-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127021342) has the molecular formula C20H22F6N4O6S and a molecular weight of 560.47 g/mol. Its IUPAC name is (3S,3aS,7aR)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-(pyridin-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3S,3aS,7aR)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-(pyridin-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127021342 |
| Molecular Formula | C20H22F6N4O6S |
| Molecular Weight | 560.47 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | (3S,3aS,7aR)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-(pyridin-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nnc(N2C[C@H](OCc3ccncc3)[C@H]3OCCC[C@H]32)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20N4O2S.2C2HF3O2/c1-11-18-19-16(23-11)20-9-14(15-13(20)3-2-8-21-15)22-10-12-4-6-17-7-5-12;2*3-2(4,5)1(6)7/h4-7,13-15H,2-3,8-10H2,1H3;2*(H,6,7)/t13-,14+,15+;;/m1../s1 |
| InChIKey | SNILEOVNAXGMDO-YSHMYPCISA-N |
| XLogP | 3.46 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |