C22H24F6N2O7 — CID 155833825
(3R,3aR,7aS)-1-(furan-3-ylmethyl)-3-(pyridin-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155833825) has the molecular formula C22H24F6N2O7 and a molecular weight of 542.43 g/mol. Its IUPAC name is (3R,3aR,7aS)-1-(furan-3-ylmethyl)-3-(pyridin-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aR,7aS)-1-(furan-3-ylmethyl)-3-(pyridin-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155833825 |
| Molecular Formula | C22H24F6N2O7 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | (3R,3aR,7aS)-1-(furan-3-ylmethyl)-3-(pyridin-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cc(CO[C@@H]2CN(Cc3ccoc3)[C@H]3CCCO[C@@H]23)ccn1 |
| InChI | InChI=1S/C18H22N2O3.2C2HF3O2/c1-2-16-18(22-8-1)17(23-13-14-3-6-19-7-4-14)11-20(16)10-15-5-9-21-12-15;2*3-2(4,5)1(6)7/h3-7,9,12,16-18H,1-2,8,10-11,13H2;2*(H,6,7)/t16-,17+,18+;;/m0../s1 |
| InChIKey | YNBRGASTEUYYEL-REUUXSTESA-N |
| XLogP | 3.89 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |