C22H24F6N2O6S — CID 155835033
(3R,3aS,7aS)-3-(pyridin-3-ylmethoxy)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155835033) has the molecular formula C22H24F6N2O6S and a molecular weight of 558.50 g/mol. Its IUPAC name is (3R,3aS,7aS)-3-(pyridin-3-ylmethoxy)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aS,7aS)-3-(pyridin-3-ylmethoxy)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155835033 |
| Molecular Formula | C22H24F6N2O6S |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | (3R,3aS,7aS)-3-(pyridin-3-ylmethoxy)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cncc(CO[C@@H]2CN(Cc3ccsc3)[C@H]3CCCO[C@H]23)c1 |
| InChI | InChI=1S/C18H22N2O2S.2C2HF3O2/c1-3-14(9-19-6-1)12-22-17-11-20(10-15-5-8-23-13-15)16-4-2-7-21-18(16)17;2*3-2(4,5)1(6)7/h1,3,5-6,8-9,13,16-18H,2,4,7,10-12H2;2*(H,6,7)/t16-,17+,18-;;/m0../s1 |
| InChIKey | XZDVIVFQSDZHET-VWRRVXQQSA-N |
| XLogP | 4.36 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |