C21H23F3N2O6 — CID 127023342
[(3R,3aS,7aS)-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(5-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127023342) has the molecular formula C21H23F3N2O6 and a molecular weight of 456.42 g/mol. Its IUPAC name is [(3R,3aS,7aS)-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(5-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3R,3aS,7aS)-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(5-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023342 |
| Molecular Formula | C21H23F3N2O6 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [(3R,3aS,7aS)-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(5-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C(=O)N2C[C@@H](OCc3cccnc3)[C@H]3OCCC[C@@H]32)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H22N2O4.C2HF3O2/c1-13-6-7-16(25-13)19(22)21-11-17(18-15(21)5-3-9-23-18)24-12-14-4-2-8-20-10-14;3-2(4,5)1(6)7/h2,4,6-8,10,15,17-18H,3,5,9,11-12H2,1H3;(H,6,7)/t15-,17+,18-;/m0./s1 |
| InChIKey | FROALFPPVKWBJF-KLWZODLKSA-N |
| XLogP | 3.21 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |