C24H25F7N2O6 — CID 155848632
(3R,3aS,7aR)-1-[(4-fluorophenyl)methyl]-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155848632) has the molecular formula C24H25F7N2O6 and a molecular weight of 570.46 g/mol. Its IUPAC name is (3R,3aS,7aR)-1-[(4-fluorophenyl)methyl]-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aS,7aR)-1-[(4-fluorophenyl)methyl]-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155848632 |
| Molecular Formula | C24H25F7N2O6 |
| Molecular Weight | 570.46 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | (3R,3aS,7aR)-1-[(4-fluorophenyl)methyl]-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Fc1ccc(CN2C[C@@H](OCc3cccnc3)[C@H]3OCCC[C@H]32)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23FN2O2.2C2HF3O2/c21-17-7-5-15(6-8-17)12-23-13-19(20-18(23)4-2-10-24-20)25-14-16-3-1-9-22-11-16;2*3-2(4,5)1(6)7/h1,3,5-9,11,18-20H,2,4,10,12-14H2;2*(H,6,7)/t18-,19-,20+;;/m1../s1 |
| InChIKey | BPBIUFRNWODGBK-FLCBSXKVSA-N |
| XLogP | 4.44 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |