C22H25F6N3O6S — CID 155854262
(3R,3aS,7aR)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155854262) has the molecular formula C22H25F6N3O6S and a molecular weight of 573.51 g/mol. Its IUPAC name is (3R,3aS,7aR)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aS,7aR)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155854262 |
| Molecular Formula | C22H25F6N3O6S |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | (3R,3aS,7aR)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(pyridin-3-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1csc(CN2C[C@@H](OCc3cccnc3)[C@H]3OCCC[C@H]32)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N3O2S.2C2HF3O2/c1-13-12-24-17(20-13)10-21-9-16(18-15(21)5-3-7-22-18)23-11-14-4-2-6-19-8-14;2*3-2(4,5)1(6)7/h2,4,6,8,12,15-16,18H,3,5,7,9-11H2,1H3;2*(H,6,7)/t15-,16-,18+;;/m1../s1 |
| InChIKey | JBWGDUZZCYQZPT-JQVFSJMQSA-N |
| XLogP | 4.06 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |