C21H23F6N3O6S — CID 155823799
(3S,3aS,7aR)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155823799) has the molecular formula C21H23F6N3O6S and a molecular weight of 559.49 g/mol. Its IUPAC name is (3S,3aS,7aR)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3S,3aS,7aR)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155823799 |
| Molecular Formula | C21H23F6N3O6S |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | (3S,3aS,7aR)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ncsc1CN1C[C@H](Oc2cccnc2)[C@H]2OCCC[C@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21N3O2S.2C2HF3O2/c1-12-16(23-11-19-12)10-20-9-15(17-14(20)5-3-7-21-17)22-13-4-2-6-18-8-13;2*3-2(4,5)1(6)7/h2,4,6,8,11,14-15,17H,3,5,7,9-10H2,1H3;2*(H,6,7)/t14-,15+,17+;;/m1../s1 |
| InChIKey | HDUMITWOBDXESY-JDPULDLWSA-N |
| XLogP | 3.92 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |