C15H20F3N3O4S — CID 155850132
(3R,3aS,7aR)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155850132) has the molecular formula C15H20F3N3O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is (3R,3aS,7aR)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aS,7aR)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155850132 |
| Molecular Formula | C15H20F3N3O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (3R,3aS,7aR)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | C=CCO[C@@H]1CN(c2nnc(C)s2)[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19N3O2S.C2HF3O2/c1-3-6-17-11-8-16(13-15-14-9(2)19-13)10-5-4-7-18-12(10)11;3-2(4,5)1(6)7/h3,10-12H,1,4-8H2,2H3;(H,6,7)/t10-,11-,12+;/m1./s1 |
| InChIKey | UIRFEUSOVUQVPB-HSASPSRMSA-N |
| XLogP | 2.42 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|