C18H25F3N2O5 — CID 155832651
(3R,3aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155832651) has the molecular formula C18H25F3N2O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is (3R,3aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155832651 |
| Molecular Formula | C18H25F3N2O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (3R,3aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | C=CCO[C@@H]1CN(Cc2c(C)noc2C)[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N2O3.C2HF3O2/c1-4-7-19-15-10-18(14-6-5-8-20-16(14)15)9-13-11(2)17-21-12(13)3;3-2(4,5)1(6)7/h4,14-16H,1,5-10H2,2-3H3;(H,6,7)/t14-,15-,16+;/m1./s1 |
| InChIKey | OORKPXXBGUYAMN-IFKKJYDISA-N |
| XLogP | 2.86 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|