C22H25F6N3O7 — CID 155848419
(3R,3aR,6aS)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(pyridin-2-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155848419) has the molecular formula C22H25F6N3O7 and a molecular weight of 557.44 g/mol. Its IUPAC name is (3R,3aR,6aS)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(pyridin-2-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aR,6aS)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(pyridin-2-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155848419 |
| Molecular Formula | C22H25F6N3O7 |
| Molecular Weight | 557.44 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | (3R,3aR,6aS)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(pyridin-2-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1noc(C)c1CN1C[C@H](OCc2ccccn2)[C@H]2COC[C@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N3O3.2C2HF3O2/c1-12-15(13(2)24-20-12)7-21-8-18(16-10-22-11-17(16)21)23-9-14-5-3-4-6-19-14;2*3-2(4,5)1(6)7/h3-6,16-18H,7-11H2,1-2H3;2*(H,6,7)/t16-,17+,18-;;/m0../s1 |
| InChIKey | RKKKARMNMNRFJO-VWRRVXQQSA-N |
| XLogP | 3.37 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |