C20H19N3O3 — CID 155902362
4-[(3R,3aR,6aS)-3-(pyridin-2-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carbonyl]benzonitrile (PubChem CID 155902362) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-[(3R,3aR,6aS)-3-(pyridin-2-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carbonyl]benzonitrile.
| Compound Name | 4-[(3R,3aR,6aS)-3-(pyridin-2-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 155902362 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-[(3R,3aR,6aS)-3-(pyridin-2-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carbonyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2C[C@H](OCc3ccccn3)[C@H]3COC[C@H]32)cc1 |
| InChI | InChI=1S/C20H19N3O3/c21-9-14-4-6-15(7-5-14)20(24)23-10-19(17-12-25-13-18(17)23)26-11-16-3-1-2-8-22-16/h1-8,17-19H,10-13H2/t17-,18+,19-/m0/s1 |
| InChIKey | ZQZZHUPFIOSWQS-OTWHNJEPSA-N |
| XLogP | 2.01 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |