C18H20N2O3 — CID 133142377
3-[(3S,3aS,6aR)-3-(cyclopropylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carbonyl]benzonitrile (PubChem CID 133142377) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-[(3S,3aS,6aR)-3-(cyclopropylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carbonyl]benzonitrile.
| Compound Name | 3-[(3S,3aS,6aR)-3-(cyclopropylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 133142377 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-[(3S,3aS,6aR)-3-(cyclopropylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carbonyl]benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2C[C@@H](OCC3CC3)[C@@H]3COC[C@@H]32)c1 |
| InChI | InChI=1S/C18H20N2O3/c19-7-13-2-1-3-14(6-13)18(21)20-8-17(23-9-12-4-5-12)15-10-22-11-16(15)20/h1-3,6,12,15-17H,4-5,8-11H2/t15-,16+,17-/m1/s1 |
| InChIKey | IQURBRKROMOPCT-IXDOHACOSA-N |
| XLogP | 1.82 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |