C19H19F3N2O5S — CID 155826994
[(3R,3aR,6aS)-3-(pyridin-3-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155826994) has the molecular formula C19H19F3N2O5S and a molecular weight of 444.43 g/mol. Its IUPAC name is [(3R,3aR,6aS)-3-(pyridin-3-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3R,3aR,6aS)-3-(pyridin-3-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826994 |
| Molecular Formula | C19H19F3N2O5S |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [(3R,3aR,6aS)-3-(pyridin-3-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccsc1)N1C[C@H](OCc2cccnc2)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C17H18N2O3S.C2HF3O2/c20-17(13-3-5-23-11-13)19-7-16(14-9-21-10-15(14)19)22-8-12-2-1-4-18-6-12;3-2(4,5)1(6)7/h1-6,11,14-16H,7-10H2;(H,6,7)/t14-,15+,16-;/m0./s1 |
| InChIKey | DAPCHARVKMZTFZ-CLUYDPBTSA-N |
| XLogP | 2.83 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |