C20H20F3N3O5S — CID 155865141
N-(pyridin-3-ylmethyl)-4-(thiophene-3-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155865141) has the molecular formula C20H20F3N3O5S and a molecular weight of 471.46 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-4-(thiophene-3-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(pyridin-3-ylmethyl)-4-(thiophene-3-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155865141 |
| Molecular Formula | C20H20F3N3O5S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-4-(thiophene-3-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1cccnc1)C1CN(C(=O)c2ccsc2)C2CCOC12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H19N3O3S.C2HF3O2/c22-17(20-9-12-2-1-5-19-8-12)14-10-21(15-3-6-24-16(14)15)18(23)13-4-7-25-11-13;3-2(4,5)1(6)7/h1-2,4-5,7-8,11,14-16H,3,6,9-10H2,(H,20,22);(H,6,7) |
| InChIKey | MPECLYHOCQICGY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |