C19H23F3N2O5S — CID 171695746
(3R,3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 171695746) has the molecular formula C19H23F3N2O5S and a molecular weight of 448.46 g/mol. Its IUPAC name is (3R,3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171695746 |
| Molecular Formula | C19H23F3N2O5S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (3R,3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2C[C@H](OCc3csc(C)n3)[C@H]3COC[C@H]32)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N2O3S.C2HF3O2/c1-11-3-4-14(22-11)5-19-6-17(15-8-20-9-16(15)19)21-7-13-10-23-12(2)18-13;3-2(4,5)1(6)7/h3-4,10,15-17H,5-9H2,1-2H3;(H,6,7)/t15-,16+,17-;/m0./s1 |
| InChIKey | HHHJCMZENBXACH-VNMUXGFYSA-N |
| XLogP | 3.40 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |