C18H20F2N2O2S — CID 155875716
(3S,3aR,6aS)-1-[(3,4-difluorophenyl)methyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole (PubChem CID 155875716) has the molecular formula C18H20F2N2O2S and a molecular weight of 366.43 g/mol. Its IUPAC name is (3S,3aR,6aS)-1-[(3,4-difluorophenyl)methyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole.
| Compound Name | (3S,3aR,6aS)-1-[(3,4-difluorophenyl)methyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
|---|---|
| PubChem CID | 155875716 |
| Molecular Formula | C18H20F2N2O2S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (3S,3aR,6aS)-1-[(3,4-difluorophenyl)methyl]-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
| SMILES | Cc1nc(CO[C@@H]2CN(Cc3ccc(F)c(F)c3)[C@@H]3COC[C@@H]32)cs1 |
| InChI | InChI=1S/C18H20F2N2O2S/c1-11-21-13(10-25-11)7-24-18-6-22(17-9-23-8-14(17)18)5-12-2-3-15(19)16(20)4-12/h2-4,10,14,17-18H,5-9H2,1H3/t14-,17+,18+/m0/s1 |
| InChIKey | SHHJVYGTSGXVGW-BMGDILEWSA-N |
| XLogP | 3.15 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |