C17H23NO3 — CID 155877326
(3S,3aR,6aS)-1-[(3-methoxyphenyl)methyl]-3-prop-2-enoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole (PubChem CID 155877326) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is (3S,3aR,6aS)-1-[(3-methoxyphenyl)methyl]-3-prop-2-enoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole.
| Compound Name | (3S,3aR,6aS)-1-[(3-methoxyphenyl)methyl]-3-prop-2-enoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
|---|---|
| PubChem CID | 155877326 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (3S,3aR,6aS)-1-[(3-methoxyphenyl)methyl]-3-prop-2-enoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
| SMILES | C=CCO[C@@H]1CN(Cc2cccc(OC)c2)[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C17H23NO3/c1-3-7-21-17-10-18(16-12-20-11-15(16)17)9-13-5-4-6-14(8-13)19-2/h3-6,8,15-17H,1,7,9-12H2,2H3/t15-,16+,17+/m0/s1 |
| InChIKey | DCHOWLGQKFNDJS-GVDBMIGSSA-N |
| XLogP | 2.10 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|