C15H24N2O3 — CID 97459507
2-[[(3R,3aR,6aS)-1-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine (PubChem CID 97459507) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[[(3R,3aR,6aS)-1-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[(3R,3aR,6aS)-1-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 97459507 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-[[(3R,3aR,6aS)-1-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCO[C@H]1CN(Cc2ccoc2)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C15H24N2O3/c1-16(2)4-6-20-15-8-17(7-12-3-5-18-9-12)14-11-19-10-13(14)15/h3,5,9,13-15H,4,6-8,10-11H2,1-2H3/t13-,14+,15-/m0/s1 |
| InChIKey | TYOTVWDQLRXSSH-ZNMIVQPWSA-N |
| XLogP | 1.06 |
| TPSA | 38.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |