C16H24N2O4S — CID 97459517
2-[[(3R,3aR,6aS)-1-(benzenesulfonyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine (PubChem CID 97459517) has the molecular formula C16H24N2O4S and a molecular weight of 340.44 g/mol. Its IUPAC name is 2-[[(3R,3aR,6aS)-1-(benzenesulfonyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[(3R,3aR,6aS)-1-(benzenesulfonyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 97459517 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-[[(3R,3aR,6aS)-1-(benzenesulfonyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCO[C@H]1CN(S(=O)(=O)c2ccccc2)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C16H24N2O4S/c1-17(2)8-9-22-16-10-18(15-12-21-11-14(15)16)23(19,20)13-6-4-3-5-7-13/h3-7,14-16H,8-12H2,1-2H3/t14-,15+,16-/m0/s1 |
| InChIKey | SYROHTFDEZUEOM-XHSDSOJGSA-N |
| XLogP | 0.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |