C14H18FNO4S — CID 124825745
(3S,3aS,6aR)-3-ethoxy-1-(3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole (PubChem CID 124825745) has the molecular formula C14H18FNO4S and a molecular weight of 315.37 g/mol. Its IUPAC name is (3S,3aS,6aR)-3-ethoxy-1-(3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole.
| Compound Name | (3S,3aS,6aR)-3-ethoxy-1-(3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
|---|---|
| PubChem CID | 124825745 |
| Molecular Formula | C14H18FNO4S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (3S,3aS,6aR)-3-ethoxy-1-(3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
| SMILES | CCO[C@@H]1CN(S(=O)(=O)c2cccc(F)c2)[C@H]2COC[C@@H]12 |
| InChI | InChI=1S/C14H18FNO4S/c1-2-20-14-7-16(13-9-19-8-12(13)14)21(17,18)11-5-3-4-10(15)6-11/h3-6,12-14H,2,7-9H2,1H3/t12-,13+,14-/m1/s1 |
| InChIKey | FLPREXJGTZOPMM-HZSPNIEDSA-N |
| XLogP | 1.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |