C19H25N3O3 — CID 97459521
[(3R,3aR,6aS)-3-[2-(dimethylamino)ethoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-indol-5-yl)methanone (PubChem CID 97459521) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is [(3R,3aR,6aS)-3-[2-(dimethylamino)ethoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-indol-5-yl)methanone.
| Compound Name | [(3R,3aR,6aS)-3-[2-(dimethylamino)ethoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 97459521 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | [(3R,3aR,6aS)-3-[2-(dimethylamino)ethoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-indol-5-yl)methanone |
| SMILES | CN(C)CCO[C@H]1CN(C(=O)c2ccc3[nH]ccc3c2)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C19H25N3O3/c1-21(2)7-8-25-18-10-22(17-12-24-11-15(17)18)19(23)14-3-4-16-13(9-14)5-6-20-16/h3-6,9,15,17-18,20H,7-8,10-12H2,1-2H3/t15-,17+,18-/m0/s1 |
| InChIKey | DWLKQMQHJXWGEI-JQHSSLGASA-N |
| XLogP | 1.59 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |