C16H19N3O — CID 121185245
1H-indol-5-yl-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 121185245) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 1H-indol-5-yl-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | 1H-indol-5-yl-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 121185245 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1H-indol-5-yl-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | CN1CC2CN(C(=O)c3ccc4[nH]ccc4c3)CC2C1 |
| InChI | InChI=1S/C16H19N3O/c1-18-7-13-9-19(10-14(13)8-18)16(20)12-2-3-15-11(6-12)4-5-17-15/h2-6,13-14,17H,7-10H2,1H3 |
| InChIKey | KIMSEKWYLFPPHN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |