C20H21N3O — CID 139458547
[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(9H-carbazol-3-yl)methanone (PubChem CID 139458547) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is [(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(9H-carbazol-3-yl)methanone.
| Compound Name | [(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(9H-carbazol-3-yl)methanone |
|---|---|
| PubChem CID | 139458547 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | [(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(9H-carbazol-3-yl)methanone |
| SMILES | CN1C[C@@H]2CN(C(=O)c3ccc4[nH]c5ccccc5c4c3)C[C@@H]2C1 |
| InChI | InChI=1S/C20H21N3O/c1-22-9-14-11-23(12-15(14)10-22)20(24)13-6-7-19-17(8-13)16-4-2-3-5-18(16)21-19/h2-8,14-15,21H,9-12H2,1H3/t14-,15+ |
| InChIKey | UTZATOYJZNGCNY-GASCZTMLSA-N |
| XLogP | 2.95 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |