C24H21N3O2 — CID 154840863
2-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl)-10H-acridin-9-one (PubChem CID 154840863) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl)-10H-acridin-9-one.
| Compound Name | 2-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl)-10H-acridin-9-one |
|---|---|
| PubChem CID | 154840863 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl)-10H-acridin-9-one |
| SMILES | CN1CCN(C(=O)c2ccc3[nH]c4ccccc4c(=O)c3c2)Cc2ccccc21 |
| InChI | InChI=1S/C24H21N3O2/c1-26-12-13-27(15-17-6-2-5-9-22(17)26)24(29)16-10-11-21-19(14-16)23(28)18-7-3-4-8-20(18)25-21/h2-11,14H,12-13,15H2,1H3,(H,25,28) |
| InChIKey | DQUHRFXFIPWWGR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|