C22H25N3O2 — CID 59019622
N-(1,4-dimethylpiperidin-4-yl)-2-methyl-9-oxo-10H-acridine-3-carboxamide (PubChem CID 59019622) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-(1,4-dimethylpiperidin-4-yl)-2-methyl-9-oxo-10H-acridine-3-carboxamide.
| Compound Name | N-(1,4-dimethylpiperidin-4-yl)-2-methyl-9-oxo-10H-acridine-3-carboxamide |
|---|---|
| PubChem CID | 59019622 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-(1,4-dimethylpiperidin-4-yl)-2-methyl-9-oxo-10H-acridine-3-carboxamide |
| SMILES | Cc1cc2c(=O)c3ccccc3[nH]c2cc1C(=O)NC1(C)CCN(C)CC1 |
| InChI | InChI=1S/C22H25N3O2/c1-14-12-17-19(23-18-7-5-4-6-15(18)20(17)26)13-16(14)21(27)24-22(2)8-10-25(3)11-9-22/h4-7,12-13H,8-11H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | QOHXFRNIHOQYPC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|