C14H18F2N2O — CID 134435231
N-(1,4-dimethylpiperidin-4-yl)-3,4-difluorobenzamide (PubChem CID 134435231) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is N-(1,4-dimethylpiperidin-4-yl)-3,4-difluorobenzamide.
| Compound Name | N-(1,4-dimethylpiperidin-4-yl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 134435231 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-(1,4-dimethylpiperidin-4-yl)-3,4-difluorobenzamide |
| SMILES | CN1CCC(C)(NC(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C14H18F2N2O/c1-14(5-7-18(2)8-6-14)17-13(19)10-3-4-11(15)12(16)9-10/h3-4,9H,5-8H2,1-2H3,(H,17,19) |
| InChIKey | RYJZGWYMWRZGLR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |