C16H23F3N2O — CID 142327101
N-(1,4-dimethylpiperidin-4-yl)-2,3,6-trifluorobenzamide;ethane (PubChem CID 142327101) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is N-(1,4-dimethylpiperidin-4-yl)-2,3,6-trifluorobenzamide;ethane.
| Compound Name | N-(1,4-dimethylpiperidin-4-yl)-2,3,6-trifluorobenzamide;ethane |
|---|---|
| PubChem CID | 142327101 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-(1,4-dimethylpiperidin-4-yl)-2,3,6-trifluorobenzamide;ethane |
| SMILES | CC.CN1CCC(C)(NC(=O)c2c(F)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C14H17F3N2O.C2H6/c1-14(5-7-19(2)8-6-14)18-13(20)11-9(15)3-4-10(16)12(11)17;1-2/h3-4H,5-8H2,1-2H3,(H,18,20);1-2H3 |
| InChIKey | VLXRSQPXOLPLJA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|