C14H15ClFN3O — CID 61124140
2-chloro-N-(4-cyano-1-methylpiperidin-4-yl)-6-fluorobenzamide (PubChem CID 61124140) has the molecular formula C14H15ClFN3O and a molecular weight of 295.74 g/mol. Its IUPAC name is 2-chloro-N-(4-cyano-1-methylpiperidin-4-yl)-6-fluorobenzamide.
| Compound Name | 2-chloro-N-(4-cyano-1-methylpiperidin-4-yl)-6-fluorobenzamide |
|---|---|
| PubChem CID | 61124140 |
| Molecular Formula | C14H15ClFN3O |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-chloro-N-(4-cyano-1-methylpiperidin-4-yl)-6-fluorobenzamide |
| SMILES | CN1CCC(C#N)(NC(=O)c2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C14H15ClFN3O/c1-19-7-5-14(9-17,6-8-19)18-13(20)12-10(15)3-2-4-11(12)16/h2-4H,5-8H2,1H3,(H,18,20) |
| InChIKey | OZZIQVQTEMHEGP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |