C15H17F2N3O — CID 115674649
N-(4-cyano-1-methylpiperidin-4-yl)-2,4-difluoro-5-methylbenzamide (PubChem CID 115674649) has the molecular formula C15H17F2N3O and a molecular weight of 293.32 g/mol. Its IUPAC name is N-(4-cyano-1-methylpiperidin-4-yl)-2,4-difluoro-5-methylbenzamide.
| Compound Name | N-(4-cyano-1-methylpiperidin-4-yl)-2,4-difluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 115674649 |
| Molecular Formula | C15H17F2N3O |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-(4-cyano-1-methylpiperidin-4-yl)-2,4-difluoro-5-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC2(C#N)CCN(C)CC2)c(F)cc1F |
| InChI | InChI=1S/C15H17F2N3O/c1-10-7-11(13(17)8-12(10)16)14(21)19-15(9-18)3-5-20(2)6-4-15/h7-8H,3-6H2,1-2H3,(H,19,21) |
| InChIKey | XLRORNAABGWLCG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |