C14H16IN3O — CID 54904713
N-(4-cyano-1-methylpiperidin-4-yl)-2-iodobenzamide (PubChem CID 54904713) has the molecular formula C14H16IN3O and a molecular weight of 369.21 g/mol. Its IUPAC name is N-(4-cyano-1-methylpiperidin-4-yl)-2-iodobenzamide.
| Compound Name | N-(4-cyano-1-methylpiperidin-4-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 54904713 |
| Molecular Formula | C14H16IN3O |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N-(4-cyano-1-methylpiperidin-4-yl)-2-iodobenzamide |
| SMILES | CN1CCC(C#N)(NC(=O)c2ccccc2I)CC1 |
| InChI | InChI=1S/C14H16IN3O/c1-18-8-6-14(10-16,7-9-18)17-13(19)11-4-2-3-5-12(11)15/h2-5H,6-9H2,1H3,(H,17,19) |
| InChIKey | MYONXAFLNYFLDD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|