C14H16ClN3O2 — CID 106500981
2-chloro-N-(4-cyano-1-methylpiperidin-4-yl)-5-hydroxybenzamide (PubChem CID 106500981) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is 2-chloro-N-(4-cyano-1-methylpiperidin-4-yl)-5-hydroxybenzamide.
| Compound Name | 2-chloro-N-(4-cyano-1-methylpiperidin-4-yl)-5-hydroxybenzamide |
|---|---|
| PubChem CID | 106500981 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-chloro-N-(4-cyano-1-methylpiperidin-4-yl)-5-hydroxybenzamide |
| SMILES | CN1CCC(C#N)(NC(=O)c2cc(O)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H16ClN3O2/c1-18-6-4-14(9-16,5-7-18)17-13(20)11-8-10(19)2-3-12(11)15/h2-3,8,19H,4-7H2,1H3,(H,17,20) |
| InChIKey | DBNPJROLFZXORO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |